About 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one
6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one (PubChem CID 12002419) has the molecular formula C19H6Cl4O5
and a molecular weight of 456.06 g/mol. Its IUPAC name is 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one.
Molecular Properties
| Compound Name | 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one |
| PubChem CID | 12002419 |
| Molecular Formula | C19H6Cl4O5 |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 453.90 |
| IUPAC Name | 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one |
| SMILES | O=C(c1cc2cc(Cl)cc(Cl)c2oc1=O)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C19H6Cl4O5/c20-9-1-7-3-11(18(25)27-16(7)13(22)5-9)15(24)12-4-8-2-10(21)6-14(23)17(8)28-19(12)26/h1-6H |
| InChIKey | ODVPDBHGTSHGMJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one?
The IUPAC name of 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one (CID 12002419) is 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one.
What is the SMILES notation for 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one?
The canonical SMILES for 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one is O=C(c1cc2cc(Cl)cc(Cl)c2oc1=O)c1cc2cc(Cl)cc(Cl)c2oc1=O.
What is the InChIKey of 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one?
The InChIKey is ODVPDBHGTSHGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H6Cl4O5/c20-9-1-7-3-11(18(25)27-16(7)13(22)5-9)15(24)12-4-8-2-10(21)6-14(23)17(8)28-19(12)26/h1-6H.
What are the key properties of 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one?
6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one has a molecular weight of 456.06 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-3-(6,8-dichloro-2-oxochromene-3-carbonyl)chromen-2-one is sourced from PubChem (CID 12002419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).