C21H17FN2O4S2 — CID 12002432
4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one (PubChem CID 12002432) has the molecular formula C21H17FN2O4S2 and a molecular weight of 444.51 g/mol. Its IUPAC name is 4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | 4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 12002432 |
| Molecular Formula | C21H17FN2O4S2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C3/SC(=S)NC3=O)cc2F)cc1 |
| InChI | InChI=1S/C21H17FN2O4S2/c1-24-14(11-27-21(24)26)8-12-2-5-15(6-3-12)28-17-7-4-13(9-16(17)22)10-18-19(25)23-20(29)30-18/h2-7,9-10,14H,8,11H2,1H3,(H,23,25,29)/b18-10+ |
| InChIKey | UOGDAJOZDPXIAZ-VCHYOVAHSA-N |
| XLogP | 4.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|