C22H19FN2O4S2 — CID 12002434
3-ethyl-4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 12002434) has the molecular formula C22H19FN2O4S2 and a molecular weight of 458.54 g/mol. Its IUPAC name is 3-ethyl-4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-ethyl-4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 12002434 |
| Molecular Formula | C22H19FN2O4S2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 3-ethyl-4-[[4-[2-fluoro-4-[(E)-(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | CCN1C(=O)OCC1Cc1ccc(Oc2ccc(/C=C3/SC(=S)NC3=O)cc2F)cc1 |
| InChI | InChI=1S/C22H19FN2O4S2/c1-2-25-15(12-28-22(25)27)9-13-3-6-16(7-4-13)29-18-8-5-14(10-17(18)23)11-19-20(26)24-21(30)31-19/h3-8,10-11,15H,2,9,12H2,1H3,(H,24,26,30)/b19-11+ |
| InChIKey | MXKJACLOMNSYMB-YBFXNURJSA-N |
| XLogP | 4.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|