About bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane
bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane (PubChem CID 12002751) has the molecular formula C20H15AuF6NO4PS2
and a molecular weight of 739.41 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane |
| PubChem CID | 12002751 |
| Molecular Formula | C20H15AuF6NO4PS2 |
| Molecular Weight | 739.41 g/mol |
| Exact Mass | 738.97 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Au+].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C2F6NO4S2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h1-15H;;/q;-1;+1 |
| InChIKey | GJWZOHAPYGHXHP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 739.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane (CID 12002751) is bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane is O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.[Au+].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane?
The InChIKey is GJWZOHAPYGHXHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C2F6NO4S2.Au/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8;/h1-15H;;/q;-1;+1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane?
bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane has a molecular weight of 739.41 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;gold(1+);triphenylphosphane is sourced from PubChem (CID 12002751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).