About 5-bromo-1,2-benzoxazole
5-bromo-1,2-benzoxazole (PubChem CID 12003029) has the molecular formula C7H4BrNO
and a molecular weight of 198.02 g/mol. Its IUPAC name is 5-bromo-1,2-benzoxazole.
Molecular Properties
| Compound Name | 5-bromo-1,2-benzoxazole |
| PubChem CID | 12003029 |
| Molecular Formula | C7H4BrNO |
| Molecular Weight | 198.02 g/mol |
| Exact Mass | 196.95 |
| IUPAC Name | 5-bromo-1,2-benzoxazole |
| SMILES | Brc1ccc2oncc2c1 |
| InChI | InChI=1S/C7H4BrNO/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H |
| InChIKey | XAGKLUNARLSYDT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.02 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,2-benzoxazole?
The IUPAC name of 5-bromo-1,2-benzoxazole (CID 12003029) is 5-bromo-1,2-benzoxazole.
What is the SMILES notation for 5-bromo-1,2-benzoxazole?
The canonical SMILES for 5-bromo-1,2-benzoxazole is Brc1ccc2oncc2c1.
What is the InChIKey of 5-bromo-1,2-benzoxazole?
The InChIKey is XAGKLUNARLSYDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNO/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H.
What are the key properties of 5-bromo-1,2-benzoxazole?
5-bromo-1,2-benzoxazole has a molecular weight of 198.02 g/mol, XLogP of 2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,2-benzoxazole is sourced from PubChem (CID 12003029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).