2-(ethylamino)propanoic acid

C5H11NO2 — CID 12003148

IUPAC2-(ethylamino)propanoic acid
SMILESCCNC(C)C(=O)O
InChIInChI=1S/C5H11NO2/c1-3-6-4(2)5(7)8/h4,6H,3H2,1-2H3,(H,7,8)
InChIKeyDATPFTPVGIHCCM-UHFFFAOYSA-N
MW117.15 g/mol
LogP0.07
Rot. Bonds3

About 2-(ethylamino)propanoic acid

2-(ethylamino)propanoic acid (PubChem CID 12003148) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is 2-(ethylamino)propanoic acid.

Molecular Properties

Compound Name2-(ethylamino)propanoic acid
PubChem CID12003148
Molecular FormulaC5H11NO2
Molecular Weight117.15 g/mol
Exact Mass117.08
IUPAC Name2-(ethylamino)propanoic acid
SMILESCCNC(C)C(=O)O
InChIInChI=1S/C5H11NO2/c1-3-6-4(2)5(7)8/h4,6H,3H2,1-2H3,(H,7,8)
InChIKeyDATPFTPVGIHCCM-UHFFFAOYSA-N
XLogP0.07
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500117.15
LogP ≤ 50.07
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(ethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(ethylamino)propanoic acid?
The IUPAC name of 2-(ethylamino)propanoic acid (CID 12003148) is 2-(ethylamino)propanoic acid.
What is the SMILES notation for 2-(ethylamino)propanoic acid?
The canonical SMILES for 2-(ethylamino)propanoic acid is CCNC(C)C(=O)O.
What is the InChIKey of 2-(ethylamino)propanoic acid?
The InChIKey is DATPFTPVGIHCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-3-6-4(2)5(7)8/h4,6H,3H2,1-2H3,(H,7,8).
What are the key properties of 2-(ethylamino)propanoic acid?
2-(ethylamino)propanoic acid has a molecular weight of 117.15 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)propanoic acid is sourced from PubChem (CID 12003148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).