About 2-(ethylamino)propanoic acid
2-(ethylamino)propanoic acid (PubChem CID 12003148) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2-(ethylamino)propanoic acid.
Molecular Properties
| Compound Name | 2-(ethylamino)propanoic acid |
| PubChem CID | 12003148 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 2-(ethylamino)propanoic acid |
| SMILES | CCNC(C)C(=O)O |
| InChI | InChI=1S/C5H11NO2/c1-3-6-4(2)5(7)8/h4,6H,3H2,1-2H3,(H,7,8) |
| InChIKey | DATPFTPVGIHCCM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)propanoic acid?
The IUPAC name of 2-(ethylamino)propanoic acid (CID 12003148) is 2-(ethylamino)propanoic acid.
What is the SMILES notation for 2-(ethylamino)propanoic acid?
The canonical SMILES for 2-(ethylamino)propanoic acid is CCNC(C)C(=O)O.
What is the InChIKey of 2-(ethylamino)propanoic acid?
The InChIKey is DATPFTPVGIHCCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c1-3-6-4(2)5(7)8/h4,6H,3H2,1-2H3,(H,7,8).
What are the key properties of 2-(ethylamino)propanoic acid?
2-(ethylamino)propanoic acid has a molecular weight of 117.15 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)propanoic acid is sourced from PubChem (CID 12003148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).