C19H24O2 — CID 12003260
(2R,4S,6R)-4-ethenyl-4,6-diethyl-2-phenyl-6-prop-1-ynyl-1,3-dioxane (PubChem CID 12003260) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R,4S,6R)-4-ethenyl-4,6-diethyl-2-phenyl-6-prop-1-ynyl-1,3-dioxane.
| Compound Name | (2R,4S,6R)-4-ethenyl-4,6-diethyl-2-phenyl-6-prop-1-ynyl-1,3-dioxane |
|---|---|
| PubChem CID | 12003260 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (2R,4S,6R)-4-ethenyl-4,6-diethyl-2-phenyl-6-prop-1-ynyl-1,3-dioxane |
| SMILES | C=C[C@]1(CC)C[C@@](C#CC)(CC)O[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C19H24O2/c1-5-14-19(8-4)15-18(6-2,7-3)20-17(21-19)16-12-10-9-11-13-16/h6,9-13,17H,2,7-8,15H2,1,3-4H3/t17-,18+,19+/m1/s1 |
| InChIKey | ZBGOUNNYQHUTNC-QYZOEREBSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|