C30H48O7SSi — CID 12003297
(1S,2R,3R,4R)-3-(benzenesulfonylmethyl)-2-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentan-1-ol (PubChem CID 12003297) has the molecular formula C30H48O7SSi and a molecular weight of 580.86 g/mol. Its IUPAC name is (1S,2R,3R,4R)-3-(benzenesulfonylmethyl)-2-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentan-1-ol.
| Compound Name | (1S,2R,3R,4R)-3-(benzenesulfonylmethyl)-2-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 12003297 |
| Molecular Formula | C30H48O7SSi |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | (1S,2R,3R,4R)-3-(benzenesulfonylmethyl)-2-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@H](O)[C@H](C/C=C\CCCC23OCC(C)(CO2)CO3)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H48O7SSi/c1-5-39(6-2,7-3)37-28-19-27(31)25(26(28)20-38(32,33)24-15-11-10-12-16-24)17-13-8-9-14-18-30-34-21-29(4,22-35-30)23-36-30/h8,10-13,15-16,25-28,31H,5-7,9,14,17-23H2,1-4H3/b13-8-/t25-,26-,27+,28-,29?,30?/m1/s1 |
| InChIKey | GCGFDOHGWRKZHT-HWADZYRKSA-N |
| XLogP | 5.70 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|