C13H9F3N2O2 — CID 12003490
5-(2,3,5-trifluorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxylic acid (PubChem CID 12003490) has the molecular formula C13H9F3N2O2 and a molecular weight of 282.22 g/mol. Its IUPAC name is 5-(2,3,5-trifluorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxylic acid.
| Compound Name | 5-(2,3,5-trifluorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 12003490 |
| Molecular Formula | C13H9F3N2O2 |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(2,3,5-trifluorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1n[nH]c2c1CC(c1cc(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C13H9F3N2O2/c14-6-3-7(11(16)9(15)4-6)5-1-8-10(2-5)17-18-12(8)13(19)20/h3-5H,1-2H2,(H,17,18)(H,19,20) |
| InChIKey | RLMNVSLAEYDKEG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|