C14H11F3N2O2 — CID 12003787
5-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid (PubChem CID 12003787) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is 5-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid.
| Compound Name | 5-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 12003787 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-(2,3,5-trifluorophenyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxylic acid |
| SMILES | O=C(O)c1n[nH]c2c1CC(c1cc(F)cc(F)c1F)CC2 |
| InChI | InChI=1S/C14H11F3N2O2/c15-7-4-8(12(17)10(16)5-7)6-1-2-11-9(3-6)13(14(20)21)19-18-11/h4-6H,1-3H2,(H,18,19)(H,20,21) |
| InChIKey | DKRWTSSIUWFPPD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|