About 2,4-dibromoaniline
2,4-dibromoaniline (PubChem CID 12004) has the molecular formula C6H5Br2N
and a molecular weight of 250.92 g/mol. Its IUPAC name is 2,4-dibromoaniline.
Molecular Properties
| Compound Name | 2,4-dibromoaniline |
| PubChem CID | 12004 |
| Molecular Formula | C6H5Br2N |
| Molecular Weight | 250.92 g/mol |
| Exact Mass | 248.88 |
| IUPAC Name | 2,4-dibromoaniline |
| SMILES | Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C6H5Br2N/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| InChIKey | DYSRXWYRUJCNFI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromoaniline?
The IUPAC name of 2,4-dibromoaniline (CID 12004) is 2,4-dibromoaniline.
What is the SMILES notation for 2,4-dibromoaniline?
The canonical SMILES for 2,4-dibromoaniline is Nc1ccc(Br)cc1Br.
What is the InChIKey of 2,4-dibromoaniline?
The InChIKey is DYSRXWYRUJCNFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br2N/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2.
What are the key properties of 2,4-dibromoaniline?
2,4-dibromoaniline has a molecular weight of 250.92 g/mol, XLogP of 2.79, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromoaniline is sourced from PubChem (CID 12004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).