C16H17NO3 — CID 12004086
5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-1(17),2,4(8),9-tetraen-13-one (PubChem CID 12004086) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-1(17),2,4(8),9-tetraen-13-one.
| Compound Name | 5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-1(17),2,4(8),9-tetraen-13-one |
|---|---|
| PubChem CID | 12004086 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5,7-dioxa-12-azatetracyclo[10.5.2.02,10.04,8]nonadeca-1(17),2,4(8),9-tetraen-13-one |
| SMILES | O=C1CCCC=C2CCN1Cc1cc3c(cc12)OCO3 |
| InChI | InChI=1S/C16H17NO3/c18-16-4-2-1-3-11-5-6-17(16)9-12-7-14-15(8-13(11)12)20-10-19-14/h3,7-8H,1-2,4-6,9-10H2 |
| InChIKey | KGDUOXQOYLWCEY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |