C26H30ClN5O3S — CID 1200426
3-(3-chlorophenyl)-1-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]methyl]-1-propan-2-ylurea (PubChem CID 1200426) has the molecular formula C26H30ClN5O3S and a molecular weight of 528.08 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]methyl]-1-propan-2-ylurea.
| Compound Name | 3-(3-chlorophenyl)-1-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]methyl]-1-propan-2-ylurea |
|---|---|
| PubChem CID | 1200426 |
| Molecular Formula | C26H30ClN5O3S |
| Molecular Weight | 528.08 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[[4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-1,3-thiazol-2-yl]methyl]-1-propan-2-ylurea |
| SMILES | COc1ccc(N2CCN(C(=O)c3csc(CN(C(=O)Nc4cccc(Cl)c4)C(C)C)n3)CC2)cc1 |
| InChI | InChI=1S/C26H30ClN5O3S/c1-18(2)32(26(34)28-20-6-4-5-19(27)15-20)16-24-29-23(17-36-24)25(33)31-13-11-30(12-14-31)21-7-9-22(35-3)10-8-21/h4-10,15,17-18H,11-14,16H2,1-3H3,(H,28,34) |
| InChIKey | XQJCFUCOVKMIKI-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.08 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|