C19H16F3NO4 — CID 12004354
3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(4,4,4-trifluorobutyl)indol-2-one (PubChem CID 12004354) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(4,4,4-trifluorobutyl)indol-2-one.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(4,4,4-trifluorobutyl)indol-2-one |
|---|---|
| PubChem CID | 12004354 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxy-1-(4,4,4-trifluorobutyl)indol-2-one |
| SMILES | O=C1N(CCCC(F)(F)F)c2ccccc2C1(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16F3NO4/c20-18(21,22)8-3-9-23-14-5-2-1-4-13(14)19(25,17(23)24)12-6-7-15-16(10-12)27-11-26-15/h1-2,4-7,10,25H,3,8-9,11H2 |
| InChIKey | HSQLLHOPQIDVOL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |