About 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one
3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one (PubChem CID 12004355) has the molecular formula C22H15NO6
and a molecular weight of 389.36 g/mol. Its IUPAC name is 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one.
Molecular Properties
| Compound Name | 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one |
| PubChem CID | 12004355 |
| Molecular Formula | C22H15NO6 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one |
| SMILES | O=C1Nc2c(-c3ccc4c(c3)OCO4)cccc2C1(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H15NO6/c24-21-22(25,13-5-7-17-19(9-13)29-11-27-17)15-3-1-2-14(20(15)23-21)12-4-6-16-18(8-12)28-10-26-16/h1-9,25H,10-11H2,(H,23,24) |
| InChIKey | CYWRVHXOPVXYAQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one?
The IUPAC name of 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one (CID 12004355) is 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one.
What is the SMILES notation for 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one?
The canonical SMILES for 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one is O=C1Nc2c(-c3ccc4c(c3)OCO4)cccc2C1(O)c1ccc2c(c1)OCO2.
What is the InChIKey of 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one?
The InChIKey is CYWRVHXOPVXYAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO6/c24-21-22(25,13-5-7-17-19(9-13)29-11-27-17)15-3-1-2-14(20(15)23-21)12-4-6-16-18(8-12)28-10-26-16/h1-9,25H,10-11H2,(H,23,24).
What are the key properties of 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one?
3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one has a molecular weight of 389.36 g/mol, XLogP of 3.00, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(1,3-benzodioxol-5-yl)-3-hydroxy-1H-indol-2-one is sourced from PubChem (CID 12004355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).