C21H28N8O3 — CID 12004374
4-[6-amino-5-[(E)-ethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide (PubChem CID 12004374) has the molecular formula C21H28N8O3 and a molecular weight of 440.51 g/mol. Its IUPAC name is 4-[6-amino-5-[(E)-ethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide.
| Compound Name | 4-[6-amino-5-[(E)-ethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 12004374 |
| Molecular Formula | C21H28N8O3 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 4-[6-amino-5-[(E)-ethoxyiminomethyl]pyrimidin-4-yl]-N-(6-cyclobutyloxy-3-pyridinyl)piperazine-1-carboxamide |
| SMILES | CCO/N=C/c1c(N)ncnc1N1CCN(C(=O)Nc2ccc(OC3CCC3)nc2)CC1 |
| InChI | InChI=1S/C21H28N8O3/c1-2-31-26-13-17-19(22)24-14-25-20(17)28-8-10-29(11-9-28)21(30)27-15-6-7-18(23-12-15)32-16-4-3-5-16/h6-7,12-14,16H,2-5,8-11H2,1H3,(H,27,30)(H2,22,24,25)/b26-13+ |
| InChIKey | SYVQNUPNCHEJHR-LGJNPRDNSA-N |
| XLogP | 2.11 |
| TPSA | 131.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|