C25H32O8 — CID 12004410
methyl (4aR,6S,7R,9S,10aS,10bR)-9-butanoyloxy-2-(furan-3-yl)-6,10b-dimethyl-4,10-dioxo-1,2,4a,5,6,6a,7,8,9,10a-decahydrobenzo[f]isochromene-7-carboxylate (PubChem CID 12004410) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is methyl (4aR,6S,7R,9S,10aS,10bR)-9-butanoyloxy-2-(furan-3-yl)-6,10b-dimethyl-4,10-dioxo-1,2,4a,5,6,6a,7,8,9,10a-decahydrobenzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (4aR,6S,7R,9S,10aS,10bR)-9-butanoyloxy-2-(furan-3-yl)-6,10b-dimethyl-4,10-dioxo-1,2,4a,5,6,6a,7,8,9,10a-decahydrobenzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 12004410 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | methyl (4aR,6S,7R,9S,10aS,10bR)-9-butanoyloxy-2-(furan-3-yl)-6,10b-dimethyl-4,10-dioxo-1,2,4a,5,6,6a,7,8,9,10a-decahydrobenzo[f]isochromene-7-carboxylate |
| SMILES | CCCC(=O)O[C@H]1C[C@@H](C(=O)OC)C2C(C)C[C@H]3C(=O)OC(c4ccoc4)C[C@]3(C)[C@H]2C1=O |
| InChI | InChI=1S/C25H32O8/c1-5-6-19(26)32-17-10-15(23(28)30-4)20-13(2)9-16-24(29)33-18(14-7-8-31-12-14)11-25(16,3)21(20)22(17)27/h7-8,12-13,15-18,20-21H,5-6,9-11H2,1-4H3/t13?,15-,16+,17+,18?,20?,21-,25+/m1/s1 |
| InChIKey | ZINLPCWUZSXICB-LNPCJIKRSA-N |
| XLogP | 3.64 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|