C19H16N4 — CID 12004500
(1R,8aS)-4-amino-1-phenyl-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile (PubChem CID 12004500) has the molecular formula C19H16N4 and a molecular weight of 300.36 g/mol. Its IUPAC name is (1R,8aS)-4-amino-1-phenyl-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile.
| Compound Name | (1R,8aS)-4-amino-1-phenyl-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile |
|---|---|
| PubChem CID | 12004500 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (1R,8aS)-4-amino-1-phenyl-6,7,8,8a-tetrahydro-1H-naphthalene-2,2,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C2=CCCC[C@H]2[C@H](c2ccccc2)C1(C#N)C#N |
| InChI | InChI=1S/C19H16N4/c20-10-16-18(23)15-9-5-4-8-14(15)17(19(16,11-21)12-22)13-6-2-1-3-7-13/h1-3,6-7,9,14,17H,4-5,8,23H2/t14-,17+/m1/s1 |
| InChIKey | PLHRKJLUDYEQLW-PBHICJAKSA-N |
| XLogP | 3.28 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |