About 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride
5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride (PubChem CID 12004501) has the molecular formula C20H24ClNO
and a molecular weight of 329.87 g/mol. Its IUPAC name is 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride |
| PubChem CID | 12004501 |
| Molecular Formula | C20H24ClNO |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride |
| SMILES | COC(C#CCCN(C)C)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H23NO.ClH/c1-21(2)17-11-10-16-20(22-3,18-12-6-4-7-13-18)19-14-8-5-9-15-19;/h4-9,12-15H,11,17H2,1-3H3;1H |
| InChIKey | ZXSRFHQCNPGPHE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride?
The IUPAC name of 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride (CID 12004501) is 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride.
What is the SMILES notation for 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride?
The canonical SMILES for 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride is COC(C#CCCN(C)C)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride?
The InChIKey is ZXSRFHQCNPGPHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO.ClH/c1-21(2)17-11-10-16-20(22-3,18-12-6-4-7-13-18)19-14-8-5-9-15-19;/h4-9,12-15H,11,17H2,1-3H3;1H.
What are the key properties of 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride?
5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride has a molecular weight of 329.87 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-N,N-dimethyl-5,5-diphenylpent-3-yn-1-amine;hydrochloride is sourced from PubChem (CID 12004501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).