About 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide
2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide (PubChem CID 12004643) has the molecular formula C16H17BrN2S
and a molecular weight of 349.30 g/mol. Its IUPAC name is 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide.
Molecular Properties
| Compound Name | 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide |
| PubChem CID | 12004643 |
| Molecular Formula | C16H17BrN2S |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide |
| SMILES | Br.CCCSc1ccc2nc(-c3ccccc3)cn2c1 |
| InChI | InChI=1S/C16H16N2S.BrH/c1-2-10-19-14-8-9-16-17-15(12-18(16)11-14)13-6-4-3-5-7-13;/h3-9,11-12H,2,10H2,1H3;1H |
| InChIKey | TUOMZGMNXIYWPW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide?
The IUPAC name of 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide (CID 12004643) is 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide.
What is the SMILES notation for 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide?
The canonical SMILES for 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide is Br.CCCSc1ccc2nc(-c3ccccc3)cn2c1.
What is the InChIKey of 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide?
The InChIKey is TUOMZGMNXIYWPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2S.BrH/c1-2-10-19-14-8-9-16-17-15(12-18(16)11-14)13-6-4-3-5-7-13;/h3-9,11-12H,2,10H2,1H3;1H.
What are the key properties of 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide?
2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide has a molecular weight of 349.30 g/mol, XLogP of 5.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-6-propylsulfanylimidazo[1,2-a]pyridine;hydrobromide is sourced from PubChem (CID 12004643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).