C25H18N2O3 — CID 12004644
N-[(19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide (PubChem CID 12004644) has the molecular formula C25H18N2O3 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-[(19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide.
| Compound Name | N-[(19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide |
|---|---|
| PubChem CID | 12004644 |
| Molecular Formula | C25H18N2O3 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[(19S)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-17-yl]benzamide |
| SMILES | O=C(NN1C(=O)C2C3c4ccccc4C(c4ccccc43)[C@@H]2C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H18N2O3/c28-23(14-8-2-1-3-9-14)26-27-24(29)21-19-15-10-4-5-11-16(15)20(22(21)25(27)30)18-13-7-6-12-17(18)19/h1-13,19-22H,(H,26,28)/t19?,20?,21-,22?/m0/s1 |
| InChIKey | OWMNRTGDIQUYRP-GMONCZTGSA-N |
| XLogP | 3.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|