About N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide
N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 12004655) has the molecular formula C12H18N4O2
and a molecular weight of 250.30 g/mol. Its IUPAC name is N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| PubChem CID | 12004655 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=Nc1cc(=O)n(C)c(=O)n1CC1CC1 |
| InChI | InChI=1S/C12H18N4O2/c1-14(2)8-13-10-6-11(17)15(3)12(18)16(10)7-9-4-5-9/h6,8-9H,4-5,7H2,1-3H3 |
| InChIKey | YEYXJVIFIFOOSA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 59.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
The IUPAC name of N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide (CID 12004655) is N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide is CN(C)C=Nc1cc(=O)n(C)c(=O)n1CC1CC1.
What is the InChIKey of N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
The InChIKey is YEYXJVIFIFOOSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O2/c1-14(2)8-13-10-6-11(17)15(3)12(18)16(10)7-9-4-5-9/h6,8-9H,4-5,7H2,1-3H3.
What are the key properties of N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide has a molecular weight of 250.30 g/mol, XLogP of 0.18, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(cyclopropylmethyl)-1-methyl-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide is sourced from PubChem (CID 12004655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).