About 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride
2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride (PubChem CID 12004708) has the molecular formula C13H13ClN2O4S
and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride |
| PubChem CID | 12004708 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride |
| SMILES | Cc1ncsc1CCOC(=O)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C13H12N2O4S.ClH/c1-9-12(20-8-14-9)5-6-19-13(16)10-3-2-4-11(7-10)15(17)18;/h2-4,7-8H,5-6H2,1H3;1H |
| InChIKey | HQUSTXRFJJVBPS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride?
The IUPAC name of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride (CID 12004708) is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride.
What is the SMILES notation for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride?
The canonical SMILES for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride is Cc1ncsc1CCOC(=O)c1cccc([N+](=O)[O-])c1.Cl.
What is the InChIKey of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride?
The InChIKey is HQUSTXRFJJVBPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O4S.ClH/c1-9-12(20-8-14-9)5-6-19-13(16)10-3-2-4-11(7-10)15(17)18;/h2-4,7-8H,5-6H2,1H3;1H.
What are the key properties of 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride?
2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride has a molecular weight of 328.78 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate;hydrochloride is sourced from PubChem (CID 12004708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).