About 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide
3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide (PubChem CID 12004738) has the molecular formula C17H26INO2
and a molecular weight of 403.30 g/mol. Its IUPAC name is 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide |
| PubChem CID | 12004738 |
| Molecular Formula | C17H26INO2 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide |
| SMILES | Cc1ccc(CCCOC(=O)C[N+]2(C)CCCC2)cc1.[I-] |
| InChI | InChI=1S/C17H26NO2.HI/c1-15-7-9-16(10-8-15)6-5-13-20-17(19)14-18(2)11-3-4-12-18;/h7-10H,3-6,11-14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WOWZATOLGAMFHD-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide?
The IUPAC name of 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide (CID 12004738) is 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide.
What is the SMILES notation for 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide?
The canonical SMILES for 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide is Cc1ccc(CCCOC(=O)C[N+]2(C)CCCC2)cc1.[I-].
What is the InChIKey of 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide?
The InChIKey is WOWZATOLGAMFHD-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H26NO2.HI/c1-15-7-9-16(10-8-15)6-5-13-20-17(19)14-18(2)11-3-4-12-18;/h7-10H,3-6,11-14H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide?
3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide has a molecular weight of 403.30 g/mol, XLogP of -0.28, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)propyl 2-(1-methylpyrrolidin-1-ium-1-yl)acetate iodide is sourced from PubChem (CID 12004738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).