C18H22N2O7 — CID 12004758
(4-methoxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) 3,5-dinitrobenzoate (PubChem CID 12004758) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is (4-methoxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) 3,5-dinitrobenzoate.
| Compound Name | (4-methoxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 12004758 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (4-methoxy-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanyl) 3,5-dinitrobenzoate |
| SMILES | COC1(C)CC2C(CC1OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C2(C)C |
| InChI | InChI=1S/C18H22N2O7/c1-17(2)13-8-15(18(3,26-4)9-14(13)17)27-16(21)10-5-11(19(22)23)7-12(6-10)20(24)25/h5-7,13-15H,8-9H2,1-4H3 |
| InChIKey | WNNYYHMQXUVYGL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|