About 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one
3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 12004848) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 12004848 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | CCCCOc1ccc(C2=NNC(=O)CC2)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-2-3-10-18-12-6-4-11(5-7-12)13-8-9-14(17)16-15-13/h4-7H,2-3,8-10H2,1H3,(H,16,17) |
| InChIKey | UCBSDEIESXJXND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one (CID 12004848) is 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one is CCCCOc1ccc(C2=NNC(=O)CC2)cc1.
What is the InChIKey of 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is UCBSDEIESXJXND-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-2-3-10-18-12-6-4-11(5-7-12)13-8-9-14(17)16-15-13/h4-7H,2-3,8-10H2,1H3,(H,16,17).
What are the key properties of 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one?
3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 246.31 g/mol, XLogP of 2.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-butoxyphenyl)-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 12004848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).