C22H19ClN2O2 — CID 12004861
N-(4-acetylphenyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carboxamide (PubChem CID 12004861) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is N-(4-acetylphenyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carboxamide |
|---|---|
| PubChem CID | 12004861 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | N-(4-acetylphenyl)-9-chloro-5,6,7,8-tetrahydroacridine-3-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccc3c(Cl)c4c(nc3c2)CCCC4)cc1 |
| InChI | InChI=1S/C22H19ClN2O2/c1-13(26)14-6-9-16(10-7-14)24-22(27)15-8-11-18-20(12-15)25-19-5-3-2-4-17(19)21(18)23/h6-12H,2-5H2,1H3,(H,24,27) |
| InChIKey | PYBVSTTXLOERMC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |