C24H22ClN3O5S — CID 12004882
(4-benzylpiperazin-1-yl)-[4-(3-chlorophenyl)sulfonyl-3-nitrophenyl]methanone (PubChem CID 12004882) has the molecular formula C24H22ClN3O5S and a molecular weight of 499.98 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[4-(3-chlorophenyl)sulfonyl-3-nitrophenyl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[4-(3-chlorophenyl)sulfonyl-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 12004882 |
| Molecular Formula | C24H22ClN3O5S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[4-(3-chlorophenyl)sulfonyl-3-nitrophenyl]methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)c2cccc(Cl)c2)c([N+](=O)[O-])c1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H22ClN3O5S/c25-20-7-4-8-21(16-20)34(32,33)23-10-9-19(15-22(23)28(30)31)24(29)27-13-11-26(12-14-27)17-18-5-2-1-3-6-18/h1-10,15-16H,11-14,17H2 |
| InChIKey | KTPBMRRITWYSQL-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|