C19H12F3NO2S — CID 12004904
N-[3-(trifluoromethyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 12004904) has the molecular formula C19H12F3NO2S and a molecular weight of 375.37 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 12004904 |
| Molecular Formula | C19H12F3NO2S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C19H12F3NO2S/c20-19(21,22)12-4-3-5-13(9-12)23-18(24)16-8-11-10-25-15-7-2-1-6-14(15)17(11)26-16/h1-9H,10H2,(H,23,24) |
| InChIKey | HNRAIPZDCJHOHR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |