About N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide
N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide (PubChem CID 12004915) has the molecular formula C17H25N5S
and a molecular weight of 331.49 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide.
Molecular Properties
| Compound Name | N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide |
| PubChem CID | 12004915 |
| Molecular Formula | C17H25N5S |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide |
| SMILES | CCN(CC)CCNC(=S)N1CCn2c(nc3ccccc32)C1 |
| InChI | InChI=1S/C17H25N5S/c1-3-20(4-2)10-9-18-17(23)21-11-12-22-15-8-6-5-7-14(15)19-16(22)13-21/h5-8H,3-4,9-13H2,1-2H3,(H,18,23) |
| InChIKey | LGMJCLFEBXIOAW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide?
The IUPAC name of N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide (CID 12004915) is N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide.
What is the SMILES notation for N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide?
The canonical SMILES for N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide is CCN(CC)CCNC(=S)N1CCn2c(nc3ccccc32)C1.
What is the InChIKey of N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide?
The InChIKey is LGMJCLFEBXIOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N5S/c1-3-20(4-2)10-9-18-17(23)21-11-12-22-15-8-6-5-7-14(15)19-16(22)13-21/h5-8H,3-4,9-13H2,1-2H3,(H,18,23).
What are the key properties of N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide?
N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide has a molecular weight of 331.49 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(diethylamino)ethyl]-3,4-dihydro-1H-pyrazino[1,2-a]benzimidazole-2-carbothioamide is sourced from PubChem (CID 12004915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).