About (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone
(4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone (PubChem CID 12004944) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone |
| PubChem CID | 12004944 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone |
| SMILES | CC(C)c1onc(C(=O)N2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O4/c1-8(2)11-10(15(17)18)9(13-19-11)12(16)14-6-4-3-5-7-14/h8H,3-7H2,1-2H3 |
| InChIKey | ANHPFVIKENVWML-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
The IUPAC name of (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone (CID 12004944) is (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone is CC(C)c1onc(C(=O)N2CCCCC2)c1[N+](=O)[O-].
What is the InChIKey of (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
The InChIKey is ANHPFVIKENVWML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-8(2)11-10(15(17)18)9(13-19-11)12(16)14-6-4-3-5-7-14/h8H,3-7H2,1-2H3.
What are the key properties of (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone?
(4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone has a molecular weight of 267.28 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitro-5-propan-2-yl-1,2-oxazol-3-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 12004944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).