C21H17ClN2O4S — CID 12004995
4-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 12004995) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 4-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | 4-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 12004995 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-chloro-N-(3,4,5-trimethoxyphenyl)thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc3c(Cl)nc4ccccc4c3s2)cc(OC)c1OC |
| InChI | InChI=1S/C21H17ClN2O4S/c1-26-15-8-11(9-16(27-2)18(15)28-3)23-21(25)17-10-13-19(29-17)12-6-4-5-7-14(12)24-20(13)22/h4-10H,1-3H3,(H,23,25) |
| InChIKey | QIXALSUBLYGAIX-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|