About 2,4-dibromophenol
2,4-dibromophenol (PubChem CID 12005) has the molecular formula C6H4Br2O
and a molecular weight of 251.91 g/mol. Its IUPAC name is 2,4-dibromophenol.
Molecular Properties
| Compound Name | 2,4-dibromophenol |
| PubChem CID | 12005 |
| Molecular Formula | C6H4Br2O |
| Molecular Weight | 251.91 g/mol |
| Exact Mass | 249.86 |
| IUPAC Name | 2,4-dibromophenol |
| SMILES | Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C6H4Br2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H |
| InChIKey | FAXWFCTVSHEODL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.91 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromophenol?
The IUPAC name of 2,4-dibromophenol (CID 12005) is 2,4-dibromophenol.
What is the SMILES notation for 2,4-dibromophenol?
The canonical SMILES for 2,4-dibromophenol is Oc1ccc(Br)cc1Br.
What is the InChIKey of 2,4-dibromophenol?
The InChIKey is FAXWFCTVSHEODL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Br2O/c7-4-1-2-6(9)5(8)3-4/h1-3,9H.
What are the key properties of 2,4-dibromophenol?
2,4-dibromophenol has a molecular weight of 251.91 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromophenol is sourced from PubChem (CID 12005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).