About 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione
3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione (PubChem CID 12005148) has the molecular formula C15H18N2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione.
Molecular Properties
| Compound Name | 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione |
| PubChem CID | 12005148 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione |
| SMILES | Cc1ccc(C2=NC3(CCCCC3)NC2=S)cc1 |
| InChI | InChI=1S/C15H18N2S/c1-11-5-7-12(8-6-11)13-14(18)17-15(16-13)9-3-2-4-10-15/h5-8H,2-4,9-10H2,1H3,(H,17,18) |
| InChIKey | WVINIBXFCGMAFY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione?
The IUPAC name of 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione (CID 12005148) is 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione.
What is the SMILES notation for 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione?
The canonical SMILES for 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione is Cc1ccc(C2=NC3(CCCCC3)NC2=S)cc1.
What is the InChIKey of 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione?
The InChIKey is WVINIBXFCGMAFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2S/c1-11-5-7-12(8-6-11)13-14(18)17-15(16-13)9-3-2-4-10-15/h5-8H,2-4,9-10H2,1H3,(H,17,18).
What are the key properties of 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione?
3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione has a molecular weight of 258.39 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylphenyl)-1,4-diazaspiro[4.5]dec-3-ene-2-thione is sourced from PubChem (CID 12005148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).