About N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide
N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 12005203) has the molecular formula C13H10N4O2S2
and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide.
Molecular Properties
| Compound Name | N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide |
| PubChem CID | 12005203 |
| Molecular Formula | C13H10N4O2S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc2nsnc2c1NC(=S)NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H10N4O2S2/c1-7-4-5-8-11(17-21-16-8)10(7)14-13(20)15-12(18)9-3-2-6-19-9/h2-6H,1H3,(H2,14,15,18,20) |
| InChIKey | SKSPZNXJEWVTJV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide?
The IUPAC name of N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide (CID 12005203) is N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide.
What is the SMILES notation for N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide?
The canonical SMILES for N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide is Cc1ccc2nsnc2c1NC(=S)NC(=O)c1ccco1.
What is the InChIKey of N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide?
The InChIKey is SKSPZNXJEWVTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N4O2S2/c1-7-4-5-8-11(17-21-16-8)10(7)14-13(20)15-12(18)9-3-2-6-19-9/h2-6H,1H3,(H2,14,15,18,20).
What are the key properties of N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide?
N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide has a molecular weight of 318.38 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-2,1,3-benzothiadiazol-4-yl)carbamothioyl]furan-2-carboxamide is sourced from PubChem (CID 12005203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).