About 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one
3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one (PubChem CID 12005209) has the molecular formula C17H16ClNO2S
and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one.
Molecular Properties
| Compound Name | 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one |
| PubChem CID | 12005209 |
| Molecular Formula | C17H16ClNO2S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one |
| SMILES | CC1(C)Oc2ccccc2C(=O)C1(Cl)SNc1ccccc1 |
| InChI | InChI=1S/C17H16ClNO2S/c1-16(2)17(18,22-19-12-8-4-3-5-9-12)15(20)13-10-6-7-11-14(13)21-16/h3-11,19H,1-2H3 |
| InChIKey | ZQVUKCJMIUJAHT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one?
The IUPAC name of 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one (CID 12005209) is 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one.
What is the SMILES notation for 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one?
The canonical SMILES for 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one is CC1(C)Oc2ccccc2C(=O)C1(Cl)SNc1ccccc1.
What is the InChIKey of 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one?
The InChIKey is ZQVUKCJMIUJAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16ClNO2S/c1-16(2)17(18,22-19-12-8-4-3-5-9-12)15(20)13-10-6-7-11-14(13)21-16/h3-11,19H,1-2H3.
What are the key properties of 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one?
3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one has a molecular weight of 333.84 g/mol, XLogP of 4.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilinosulfanyl-3-chloro-2,2-dimethylchromen-4-one is sourced from PubChem (CID 12005209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).