C14H22N4OS2 — CID 12005337
1-[4-(5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl)butyl]-3-prop-2-enylthiourea (PubChem CID 12005337) has the molecular formula C14H22N4OS2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 1-[4-(5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl)butyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[4-(5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl)butyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 12005337 |
| Molecular Formula | C14H22N4OS2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 1-[4-(5-oxo-1-prop-2-enyl-2-sulfanylideneimidazolidin-4-yl)butyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NCCCCC1NC(=S)N(CC=C)C1=O |
| InChI | InChI=1S/C14H22N4OS2/c1-3-8-15-13(20)16-9-6-5-7-11-12(19)18(10-4-2)14(21)17-11/h3-4,11H,1-2,5-10H2,(H,17,21)(H2,15,16,20) |
| InChIKey | VYTLFQKHNGWPRK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|