C19H17BrF2N2S — CID 12005519
1-[4-(difluoromethylsulfanyl)phenyl]-3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium bromide (PubChem CID 12005519) has the molecular formula C19H17BrF2N2S and a molecular weight of 423.33 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium bromide.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium bromide |
|---|---|
| PubChem CID | 12005519 |
| Molecular Formula | C19H17BrF2N2S |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-4-ium bromide |
| SMILES | FC(F)Sc1ccc(-n2cc(-c3ccccc3)[n+]3c2CCC3)cc1.[Br-] |
| InChI | InChI=1S/C19H17F2N2S.BrH/c20-19(21)24-16-10-8-15(9-11-16)23-13-17(14-5-2-1-3-6-14)22-12-4-7-18(22)23;/h1-3,5-6,8-11,13,19H,4,7,12H2;1H/q+1;/p-1 |
| InChIKey | NPNCBEGPNLZPEQ-UHFFFAOYSA-M |
| XLogP | 1.70 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|