About 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide (PubChem CID 12005530) has the molecular formula C16H16BrNO3
and a molecular weight of 350.21 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide |
| PubChem CID | 12005530 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide |
| SMILES | Cc1cc[n+](CC(=O)c2ccc3c(c2)OCCO3)cc1.[Br-] |
| InChI | InChI=1S/C16H16NO3.BrH/c1-12-4-6-17(7-5-12)11-14(18)13-2-3-15-16(10-13)20-9-8-19-15;/h2-7,10H,8-9,11H2,1H3;1H/q+1;/p-1 |
| InChIKey | SVHQYEYWGLUCST-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide?
The IUPAC name of 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide (CID 12005530) is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide.
What is the SMILES notation for 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide?
The canonical SMILES for 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide is Cc1cc[n+](CC(=O)c2ccc3c(c2)OCCO3)cc1.[Br-].
What is the InChIKey of 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide?
The InChIKey is SVHQYEYWGLUCST-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16NO3.BrH/c1-12-4-6-17(7-5-12)11-14(18)13-2-3-15-16(10-13)20-9-8-19-15;/h2-7,10H,8-9,11H2,1H3;1H/q+1;/p-1.
What are the key properties of 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide?
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide has a molecular weight of 350.21 g/mol, XLogP of -1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone bromide is sourced from PubChem (CID 12005530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).