About 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide
1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide (PubChem CID 12005531) has the molecular formula C12H17BrN2O2
and a molecular weight of 301.18 g/mol. Its IUPAC name is 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide.
Molecular Properties
| Compound Name | 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide |
| PubChem CID | 12005531 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide |
| SMILES | CC(C)(C)C(=O)C[n+]1ccc(C(N)=O)cc1.[Br-] |
| InChI | InChI=1S/C12H16N2O2.BrH/c1-12(2,3)10(15)8-14-6-4-9(5-7-14)11(13)16;/h4-7H,8H2,1-3H3,(H-,13,16);1H |
| InChIKey | PQOSSDQMOUDOHI-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 64.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide?
The IUPAC name of 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide (CID 12005531) is 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide.
What is the SMILES notation for 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide?
The canonical SMILES for 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide is CC(C)(C)C(=O)C[n+]1ccc(C(N)=O)cc1.[Br-].
What is the InChIKey of 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide?
The InChIKey is PQOSSDQMOUDOHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2.BrH/c1-12(2,3)10(15)8-14-6-4-9(5-7-14)11(13)16;/h4-7H,8H2,1-3H3,(H-,13,16);1H.
What are the key properties of 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide?
1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide has a molecular weight of 301.18 g/mol, XLogP of -2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-dimethyl-2-oxobutyl)pyridin-1-ium-4-carboxamide bromide is sourced from PubChem (CID 12005531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).