About 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride
4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride (PubChem CID 12005554) has the molecular formula C16H19BrClNS2
and a molecular weight of 404.83 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride |
| PubChem CID | 12005554 |
| Molecular Formula | C16H19BrClNS2 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride |
| SMILES | CC1(C)CC(c2nc(-c3ccc(Br)cc3)cs2)CCS1.Cl |
| InChI | InChI=1S/C16H18BrNS2.ClH/c1-16(2)9-12(7-8-20-16)15-18-14(10-19-15)11-3-5-13(17)6-4-11;/h3-6,10,12H,7-9H2,1-2H3;1H |
| InChIKey | RRPFKKSAZBWFCX-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride?
The IUPAC name of 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride (CID 12005554) is 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride.
What is the SMILES notation for 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride?
The canonical SMILES for 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride is CC1(C)CC(c2nc(-c3ccc(Br)cc3)cs2)CCS1.Cl.
What is the InChIKey of 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride?
The InChIKey is RRPFKKSAZBWFCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrNS2.ClH/c1-16(2)9-12(7-8-20-16)15-18-14(10-19-15)11-3-5-13(17)6-4-11;/h3-6,10,12H,7-9H2,1-2H3;1H.
What are the key properties of 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride?
4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride has a molecular weight of 404.83 g/mol, XLogP of 6.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2-(2,2-dimethylthian-4-yl)-1,3-thiazole;hydrochloride is sourced from PubChem (CID 12005554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).