C21H18BrClN2O — CID 12005558
2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridin-4-ium bromide (PubChem CID 12005558) has the molecular formula C21H18BrClN2O and a molecular weight of 429.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridin-4-ium bromide.
| Compound Name | 2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridin-4-ium bromide |
|---|---|
| PubChem CID | 12005558 |
| Molecular Formula | C21H18BrClN2O |
| Molecular Weight | 429.75 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[(4-methoxyphenyl)methyl]imidazo[1,2-a]pyridin-4-ium bromide |
| SMILES | COc1ccc(Cn2c(-c3ccc(Cl)cc3)c[n+]3ccccc23)cc1.[Br-] |
| InChI | InChI=1S/C21H18ClN2O.BrH/c1-25-19-11-5-16(6-12-19)14-24-20(17-7-9-18(22)10-8-17)15-23-13-3-2-4-21(23)24;/h2-13,15H,14H2,1H3;1H/q+1;/p-1 |
| InChIKey | LTTXFSBKIKORKG-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 18.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.75 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|