C20H22ClN3O3 — CID 12005626
ethyl 6-ethoxy-4-(pyridin-3-ylmethylamino)quinoline-3-carboxylate;hydrochloride (PubChem CID 12005626) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is ethyl 6-ethoxy-4-(pyridin-3-ylmethylamino)quinoline-3-carboxylate;hydrochloride.
| Compound Name | ethyl 6-ethoxy-4-(pyridin-3-ylmethylamino)quinoline-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 12005626 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | ethyl 6-ethoxy-4-(pyridin-3-ylmethylamino)quinoline-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cnc2ccc(OCC)cc2c1NCc1cccnc1.Cl |
| InChI | InChI=1S/C20H21N3O3.ClH/c1-3-25-15-7-8-18-16(10-15)19(17(13-22-18)20(24)26-4-2)23-12-14-6-5-9-21-11-14;/h5-11,13H,3-4,12H2,1-2H3,(H,22,23);1H |
| InChIKey | UERNJMULYSEAOV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |