C20H19Cl3N2 — CID 12005697
1-[(3,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride (PubChem CID 12005697) has the molecular formula C20H19Cl3N2 and a molecular weight of 393.75 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride |
|---|---|
| PubChem CID | 12005697 |
| Molecular Formula | C20H19Cl3N2 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride |
| SMILES | Cc1ccc(-c2c[n+](Cc3ccc(Cl)c(Cl)c3)c3n2CCC3)cc1.[Cl-] |
| InChI | InChI=1S/C20H19Cl2N2.ClH/c1-14-4-7-16(8-5-14)19-13-23(20-3-2-10-24(19)20)12-15-6-9-17(21)18(22)11-15;/h4-9,11,13H,2-3,10,12H2,1H3;1H/q+1;/p-1 |
| InChIKey | RVEYUPORRVWHSU-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|