C23H21BrClN3O2 — CID 12005783
2-[3-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propyl]isoindole-1,3-dione bromide (PubChem CID 12005783) has the molecular formula C23H21BrClN3O2 and a molecular weight of 486.80 g/mol. Its IUPAC name is 2-[3-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propyl]isoindole-1,3-dione bromide.
| Compound Name | 2-[3-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propyl]isoindole-1,3-dione bromide |
|---|---|
| PubChem CID | 12005783 |
| Molecular Formula | C23H21BrClN3O2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 2-[3-[3-(4-chlorophenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]propyl]isoindole-1,3-dione bromide |
| SMILES | O=C1c2ccccc2C(=O)N1CCC[n+]1cc(-c2ccc(Cl)cc2)n2c1CCC2.[Br-] |
| InChI | InChI=1S/C23H21ClN3O2.BrH/c24-17-10-8-16(9-11-17)20-15-25(21-7-3-13-26(20)21)12-4-14-27-22(28)18-5-1-2-6-19(18)23(27)29;/h1-2,5-6,8-11,15H,3-4,7,12-14H2;1H/q+1;/p-1 |
| InChIKey | DHZBPNWRZLVOCN-UHFFFAOYSA-M |
| XLogP | 0.73 |
| TPSA | 46.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|