C23H25FN4O5S — CID 12005877
N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide (PubChem CID 12005877) has the molecular formula C23H25FN4O5S and a molecular weight of 488.54 g/mol. Its IUPAC name is N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide.
| Compound Name | N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 12005877 |
| Molecular Formula | C23H25FN4O5S |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | N'-[[3-(4-fluorophenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N-[2-(1H-indol-3-yl)ethyl]oxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)C(=O)NCC1OCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H25FN4O5S/c24-17-6-8-18(9-7-17)34(31,32)28-12-3-13-33-21(28)15-27-23(30)22(29)25-11-10-16-14-26-20-5-2-1-4-19(16)20/h1-2,4-9,14,21,26H,3,10-13,15H2,(H,25,29)(H,27,30) |
| InChIKey | HHFWKZDEPDSECD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|