C19H21BrN2OS — CID 12005930
7-(2-methylphenyl)-5-(4-methylphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide (PubChem CID 12005930) has the molecular formula C19H21BrN2OS and a molecular weight of 405.36 g/mol. Its IUPAC name is 7-(2-methylphenyl)-5-(4-methylphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide.
| Compound Name | 7-(2-methylphenyl)-5-(4-methylphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide |
|---|---|
| PubChem CID | 12005930 |
| Molecular Formula | C19H21BrN2OS |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 7-(2-methylphenyl)-5-(4-methylphenyl)-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide |
| SMILES | Cc1ccc(C2(O)CN(c3ccccc3C)C3=[N+]2CCS3)cc1.[Br-] |
| InChI | InChI=1S/C19H21N2OS.BrH/c1-14-7-9-16(10-8-14)19(22)13-20(18-21(19)11-12-23-18)17-6-4-3-5-15(17)2;/h3-10,22H,11-13H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | WBEXCYYJHVDMQZ-UHFFFAOYSA-M |
| XLogP | 0.09 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|