C17H17BrN2OS — CID 12005932
5,7-diphenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide (PubChem CID 12005932) has the molecular formula C17H17BrN2OS and a molecular weight of 377.31 g/mol. Its IUPAC name is 5,7-diphenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide.
| Compound Name | 5,7-diphenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide |
|---|---|
| PubChem CID | 12005932 |
| Molecular Formula | C17H17BrN2OS |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | 5,7-diphenyl-3,6-dihydro-2H-imidazo[2,1-b][1,3]thiazol-4-ium-5-ol bromide |
| SMILES | OC1(c2ccccc2)CN(c2ccccc2)C2=[N+]1CCS2.[Br-] |
| InChI | InChI=1S/C17H17N2OS.BrH/c20-17(14-7-3-1-4-8-14)13-18(15-9-5-2-6-10-15)16-19(17)11-12-21-16;/h1-10,20H,11-13H2;1H/q+1;/p-1 |
| InChIKey | LBYNXNDXQJZKTR-UHFFFAOYSA-M |
| XLogP | -0.53 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_imine_ium(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|