C19H23N3O4 — CID 12005984
N-benzyl-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide (PubChem CID 12005984) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-benzyl-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide.
| Compound Name | N-benzyl-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 12005984 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-benzyl-N'-[2-(furan-2-yl)-2-morpholin-4-ylethyl]oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)NCC(c1ccco1)N1CCOCC1 |
| InChI | InChI=1S/C19H23N3O4/c23-18(20-13-15-5-2-1-3-6-15)19(24)21-14-16(17-7-4-10-26-17)22-8-11-25-12-9-22/h1-7,10,16H,8-9,11-14H2,(H,20,23)(H,21,24) |
| InChIKey | LQOMGXFSPVGZKA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|