C26H28N6O2S — CID 12006075
4-methyl-N-[2-[6-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide (PubChem CID 12006075) has the molecular formula C26H28N6O2S and a molecular weight of 488.62 g/mol. Its IUPAC name is 4-methyl-N-[2-[6-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide.
| Compound Name | 4-methyl-N-[2-[6-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 12006075 |
| Molecular Formula | C26H28N6O2S |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-methyl-N-[2-[6-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCc2nnc3ccc(SCC(=O)Nc4c(C)cc(C)cc4C)nn23)cc1 |
| InChI | InChI=1S/C26H28N6O2S/c1-16-5-7-20(8-6-16)26(34)27-12-11-22-30-29-21-9-10-24(31-32(21)22)35-15-23(33)28-25-18(3)13-17(2)14-19(25)4/h5-10,13-14H,11-12,15H2,1-4H3,(H,27,34)(H,28,33) |
| InChIKey | VTKUYJRPQDGNSR-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |